What is the mass of benzoic acid?
122.12 g/molBenzoic acid / Molar mass
What is dihydroxybenzoic acid?
Dihydroxybenzoic acids (DHBA) are a type of phenolic acids. There are six main compounds, having all the same molecular formula C7H6O4. Those are: 2,3-Dihydroxybenzoic acid (2-Pyrocatechuic acid or hypogallic acid) 2,4-Dihydroxybenzoic acid (β-Resorcylic acid)
What is dihydroxybenzoic acid used for?
3,4-dihydroxybenzoic acid is a dihydroxybenzoic acid in which the hydroxy groups are located at positions 3 and 4. It has a role as a human xenobiotic metabolite, a plant metabolite, an antineoplastic agent, an EC 1.1. 1.25 (shikimate dehydrogenase) inhibitor and an EC 1.14.
What is the melting point of 2 4-dihydroxybenzoic acid?
208-211° C
Melting Point : 208-211° C (dec.)
What is the molar mass of c8h8?
104.15 g/molCubane / Molar mass
What is the Iupac name of cinnamic acid?
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
|---|---|
| Alternative Names | CINNAMIC ACID TRANS-CINNAMIC ACID (E)-Cinnamic acid 3-Phenylacrylic acid trans-3-Phenylacrylic acid |
| Molecular Formula | C9H8O2 |
| Molar Mass | 148.161 g/mol |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
Which is more acidic para hydroxybenzoic acid or meta hydroxybenzoic acid?
Now in structure (III) and (IV), the meta-hydroxybenzoic acid, OH group cannot exerts +R-effect but can only exert –I-effect and in para-hydroxybenzoic acid, the OH group has a strong +R-effect and it has a weak –I-effect. So, meta-hydroxybenzoic acid is more acidic than para-hydroxybenzoic acid.
What is the other name of salicylic acid?
ortho-hydroxybenzoic acid
salicylic acid, also called ortho-hydroxybenzoic acid, a white, crystalline solid that is used chiefly in the preparation of aspirin and other pharmaceutical products.
What is the common name of 2 4 dihydroxybenzoic acid?
2,4-Dihydroxybenzoic acid
| Names | |
|---|---|
| Preferred IUPAC name 2,4-Dihydroxybenzoic acid | |
| Other names β-Resorcylic acid β-Resorcinolic acid p-Hydroxysalicylic acid 2,4-DHBA | |
| Identifiers | |
| CAS Number | 89-86-1 |
What is 3d5-dihydroxybenzoic acid?
3,5-dihydroxybenzoic acid is a dihydroxybenzoic acid in which the hydroxy groups are located at positions 3 and 5. It has a role as a metabolite. It is a dihydroxybenzoic acid and a member of resorcinols.
How are dihydroxybenzoic acid units synthesized?
A.-K. Duhme-Klair, in Reference Module in Chemistry, Molecular Sciences and Chemical Engineering, 2015 Dihydroxybenzoic acid (catechol) units are synthesized from chorismate, a common aromatic amino acid precursor.
What is the patent number for 2 4 dihydroxybenzoic acid?
Peter Neumann, Ulrich Eichenauer, “Preparation of 2,4-dihydroxybenzoic acid.” U.S. Patent US4996354, issued August, 1955. The data from CAS Common Chemistry is provided under a CC-BY-NC 4.0 license, unless otherwise stated.